C18H31F3O3S2Si — CID 10503464
methyl (E)-3-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithian-2-yl]prop-2-enoate (PubChem CID 10503464) has the molecular formula C18H31F3O3S2Si and a molecular weight of 444.66 g/mol. Its IUPAC name is methyl (E)-3-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithian-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithian-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10503464 |
| Molecular Formula | C18H31F3O3S2Si |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | methyl (E)-3-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-1,3-dithian-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1(CC[C@H](O[Si](C)(C)C(C)(C)C)C(F)(F)F)SCCCS1 |
| InChI | InChI=1S/C18H31F3O3S2Si/c1-16(2,3)27(5,6)24-14(18(19,20)21)8-10-17(11-9-15(22)23-4)25-12-7-13-26-17/h9,11,14H,7-8,10,12-13H2,1-6H3/b11-9+/t14-/m0/s1 |
| InChIKey | VKFMIGPHQBKTLH-MARXPDLDSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|