C12H23NO4Si — CID 131715956
2-[[4-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-enyl]amino]acetic acid (PubChem CID 131715956) has the molecular formula C12H23NO4Si and a molecular weight of 273.41 g/mol. Its IUPAC name is 2-[[4-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-enyl]amino]acetic acid.
| Compound Name | 2-[[4-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-enyl]amino]acetic acid |
|---|---|
| PubChem CID | 131715956 |
| Molecular Formula | C12H23NO4Si |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[[4-[tert-butyl(dimethyl)silyl]oxy-4-oxobut-2-enyl]amino]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C=CCNCC(=O)O |
| InChI | InChI=1S/C12H23NO4Si/c1-12(2,3)18(4,5)17-11(16)7-6-8-13-9-10(14)15/h6-7,13H,8-9H2,1-5H3,(H,14,15) |
| InChIKey | ASVWHEDFRWESCR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|