C14H28O2SSi — CID 11087474
[tert-butyl(dimethyl)silyl] (E)-4,4-dimethyl-5-methylsulfanylpent-2-enoate (PubChem CID 11087474) has the molecular formula C14H28O2SSi and a molecular weight of 288.53 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (E)-4,4-dimethyl-5-methylsulfanylpent-2-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (E)-4,4-dimethyl-5-methylsulfanylpent-2-enoate |
|---|---|
| PubChem CID | 11087474 |
| Molecular Formula | C14H28O2SSi |
| Molecular Weight | 288.53 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (E)-4,4-dimethyl-5-methylsulfanylpent-2-enoate |
| SMILES | CSCC(C)(C)/C=C/C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2SSi/c1-13(2,3)18(7,8)16-12(15)9-10-14(4,5)11-17-6/h9-10H,11H2,1-8H3/b10-9+ |
| InChIKey | AYAUEGHJMOCPMZ-MDZDMXLPSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|