C20H32O2 — CID 144848069
benzyl (E)-2,4-dimethyl-2-propan-2-ylhex-4-enoate;ethane (PubChem CID 144848069) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is benzyl (E)-2,4-dimethyl-2-propan-2-ylhex-4-enoate;ethane.
| Compound Name | benzyl (E)-2,4-dimethyl-2-propan-2-ylhex-4-enoate;ethane |
|---|---|
| PubChem CID | 144848069 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | benzyl (E)-2,4-dimethyl-2-propan-2-ylhex-4-enoate;ethane |
| SMILES | C/C=C(\C)CC(C)(C(=O)OCc1ccccc1)C(C)C.CC |
| InChI | InChI=1S/C18H26O2.C2H6/c1-6-15(4)12-18(5,14(2)3)17(19)20-13-16-10-8-7-9-11-16;1-2/h6-11,14H,12-13H2,1-5H3;1-2H3/b15-6+; |
| InChIKey | NYEDBAJHVZLNTB-AWXXIEIHSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|