C15H18O4 — CID 102490550
benzyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate (PubChem CID 102490550) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is benzyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate.
| Compound Name | benzyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 102490550 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | benzyl (2R,3S)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
| SMILES | C=C[C@H](C)[C@@](O)(C(C)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-4-11(2)15(18,12(3)16)14(17)19-10-13-8-6-5-7-9-13/h4-9,11,18H,1,10H2,2-3H3/t11-,15+/m0/s1 |
| InChIKey | QDXQXXYCZWBUCX-XHDPSFHLSA-N |
| XLogP | 1.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|