C14H16O4 — CID 71606329
phenyl (2S,3R)-2-acetyl-2-hydroxy-3-methylpent-4-enoate (PubChem CID 71606329) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is phenyl (2S,3R)-2-acetyl-2-hydroxy-3-methylpent-4-enoate.
| Compound Name | phenyl (2S,3R)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
|---|---|
| PubChem CID | 71606329 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | phenyl (2S,3R)-2-acetyl-2-hydroxy-3-methylpent-4-enoate |
| SMILES | C=C[C@@H](C)[C@](O)(C(C)=O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H16O4/c1-4-10(2)14(17,11(3)15)13(16)18-12-8-6-5-7-9-12/h4-10,17H,1H2,2-3H3/t10-,14+/m1/s1 |
| InChIKey | RIPUSMDLZALPCV-YGRLFVJLSA-N |
| XLogP | 1.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|