C23H30O3 — CID 101421224
(E,2S,3R)-1,6-bis(phenylmethoxy)-3-propan-2-ylhex-4-en-2-ol (PubChem CID 101421224) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (E,2S,3R)-1,6-bis(phenylmethoxy)-3-propan-2-ylhex-4-en-2-ol.
| Compound Name | (E,2S,3R)-1,6-bis(phenylmethoxy)-3-propan-2-ylhex-4-en-2-ol |
|---|---|
| PubChem CID | 101421224 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (E,2S,3R)-1,6-bis(phenylmethoxy)-3-propan-2-ylhex-4-en-2-ol |
| SMILES | CC(C)[C@H](/C=C/COCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C23H30O3/c1-19(2)22(14-9-15-25-16-20-10-5-3-6-11-20)23(24)18-26-17-21-12-7-4-8-13-21/h3-14,19,22-24H,15-18H2,1-2H3/b14-9+/t22-,23+/m0/s1 |
| InChIKey | VIDSAASVHFXJCE-HMXZRNCQSA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|