C30H32O4Si — CID 10552890
[6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-oxohexa-3,4-dienyl] benzoate (PubChem CID 10552890) has the molecular formula C30H32O4Si and a molecular weight of 484.67 g/mol. Its IUPAC name is [6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-oxohexa-3,4-dienyl] benzoate.
| Compound Name | [6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-oxohexa-3,4-dienyl] benzoate |
|---|---|
| PubChem CID | 10552890 |
| Molecular Formula | C30H32O4Si |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-2-oxohexa-3,4-dienyl] benzoate |
| SMILES | CC(=C=CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32O4Si/c1-24(28(31)23-33-29(32)25-16-8-5-9-17-25)15-14-22-34-35(30(2,3)4,26-18-10-6-11-19-26)27-20-12-7-13-21-27/h5-14,16-21H,22-23H2,1-4H3 |
| InChIKey | SXMCXBCUMCGVCN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|