C22H34O7 — CID 10971617
(2R,3S)-2-[[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-3-methoxycarbonylpentanedioic acid (PubChem CID 10971617) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is (2R,3S)-2-[[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-3-methoxycarbonylpentanedioic acid.
| Compound Name | (2R,3S)-2-[[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-3-methoxycarbonylpentanedioic acid |
|---|---|
| PubChem CID | 10971617 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (2R,3S)-2-[[(1S,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-3-methoxycarbonylpentanedioic acid |
| SMILES | C=C1CCC2C(C)(C)CCC[C@]2(C)[C@H]1CO[C@@H](C(=O)O)[C@H](CC(=O)O)C(=O)OC |
| InChI | InChI=1S/C22H34O7/c1-13-7-8-16-21(2,3)9-6-10-22(16,4)15(13)12-29-18(19(25)26)14(11-17(23)24)20(27)28-5/h14-16,18H,1,6-12H2,2-5H3,(H,23,24)(H,25,26)/t14-,15-,16?,18+,22+/m0/s1 |
| InChIKey | IYZRYEITHZQKJK-BWTOCPFASA-N |
| XLogP | 3.52 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|