C29H48O8 — CID 163017270
5-butoxy-3-butoxycarbonyl-2-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-5-oxopentanoic acid (PubChem CID 163017270) has the molecular formula C29H48O8 and a molecular weight of 524.70 g/mol. Its IUPAC name is 5-butoxy-3-butoxycarbonyl-2-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-5-oxopentanoic acid.
| Compound Name | 5-butoxy-3-butoxycarbonyl-2-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163017270 |
| Molecular Formula | C29H48O8 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 5-butoxy-3-butoxycarbonyl-2-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-5-oxopentanoic acid |
| SMILES | C=C1CCC2C(C)(CO)CCCC2(C)C1COC(C(=O)O)C(CC(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C29H48O8/c1-6-8-15-35-24(31)17-21(27(34)36-16-9-7-2)25(26(32)33)37-18-22-20(3)11-12-23-28(4,19-30)13-10-14-29(22,23)5/h21-23,25,30H,3,6-19H2,1-2,4-5H3,(H,32,33) |
| InChIKey | SXVSSYHDQPCPKI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|