C25H40O8 — CID 163070037
2-[2-butoxy-1-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-2-oxoethyl]butanedioic acid (PubChem CID 163070037) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-[2-butoxy-1-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-butoxy-1-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 163070037 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 2-[2-butoxy-1-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methoxy]-2-oxoethyl]butanedioic acid |
| SMILES | C=C1CCC2C(C)(CO)CCCC2(C)C1COC(C(=O)OCCCC)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H40O8/c1-5-6-12-32-23(31)21(17(22(29)30)13-20(27)28)33-14-18-16(2)8-9-19-24(3,15-26)10-7-11-25(18,19)4/h17-19,21,26H,2,5-15H2,1,3-4H3,(H,27,28)(H,29,30) |
| InChIKey | VNLMUYUQEVFVJO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|