C25H42O4 — CID 162957806
methyl 5,5,8a-trimethyl-1-[3-methyl-5-(2-methylpropanoyloxy)pentyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate (PubChem CID 162957806) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is methyl 5,5,8a-trimethyl-1-[3-methyl-5-(2-methylpropanoyloxy)pentyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate.
| Compound Name | methyl 5,5,8a-trimethyl-1-[3-methyl-5-(2-methylpropanoyloxy)pentyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 162957806 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | methyl 5,5,8a-trimethyl-1-[3-methyl-5-(2-methylpropanoyloxy)pentyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1=CCC2C(C)(C)CCCC2(C)C1CCC(C)CCOC(=O)C(C)C |
| InChI | InChI=1S/C25H42O4/c1-17(2)22(26)29-16-13-18(3)9-11-20-19(23(27)28-7)10-12-21-24(4,5)14-8-15-25(20,21)6/h10,17-18,20-21H,8-9,11-16H2,1-7H3 |
| InChIKey | LKEDBIJRCHKPBF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |