C20H34O4 — CID 15541007
(1S,6R,8aR)-6-hydroxy-1-(5-hydroxy-3-methylpentyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid (PubChem CID 15541007) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (1S,6R,8aR)-6-hydroxy-1-(5-hydroxy-3-methylpentyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | (1S,6R,8aR)-6-hydroxy-1-(5-hydroxy-3-methylpentyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 15541007 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (1S,6R,8aR)-6-hydroxy-1-(5-hydroxy-3-methylpentyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid |
| SMILES | CC(CCO)CC[C@@H]1C(C(=O)O)=CCC2C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C20H34O4/c1-13(10-12-21)5-7-15-14(18(23)24)6-8-16-19(2,3)17(22)9-11-20(15,16)4/h6,13,15-17,21-22H,5,7-12H2,1-4H3,(H,23,24)/t13?,15-,16?,17-,20+/m1/s1 |
| InChIKey | XEDCLIOKVSOTJJ-DHBPICGASA-N |
| XLogP | 3.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |