C20H32O4 — CID 132916746
(1S,4aS,5S,8aR)-5-(hydroxymethyl)-5,8a-dimethyl-1-(4-methyl-3-oxopentyl)-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid (PubChem CID 132916746) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1S,4aS,5S,8aR)-5-(hydroxymethyl)-5,8a-dimethyl-1-(4-methyl-3-oxopentyl)-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | (1S,4aS,5S,8aR)-5-(hydroxymethyl)-5,8a-dimethyl-1-(4-methyl-3-oxopentyl)-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 132916746 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1S,4aS,5S,8aR)-5-(hydroxymethyl)-5,8a-dimethyl-1-(4-methyl-3-oxopentyl)-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylic acid |
| SMILES | CC(C)C(=O)CC[C@@H]1C(C(=O)O)=CC[C@@H]2[C@@](C)(CO)CCC[C@@]12C |
| InChI | InChI=1S/C20H32O4/c1-13(2)16(22)8-7-15-14(18(23)24)6-9-17-19(3,12-21)10-5-11-20(15,17)4/h6,13,15,17,21H,5,7-12H2,1-4H3,(H,23,24)/t15-,17-,19-,20+/m1/s1 |
| InChIKey | ZSCLKZZESQMFRD-QOJCHSLYSA-N |
| XLogP | 3.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |