C18H28O2 — CID 23427522
(Z)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-4-hydroxybut-3-en-2-one (PubChem CID 23427522) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (Z)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-4-hydroxybut-3-en-2-one.
| Compound Name | (Z)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 23427522 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (Z)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-4-hydroxybut-3-en-2-one |
| SMILES | CC(=O)/C=C(\O)[C@H]1C(C)=CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C18H28O2/c1-12-7-8-15-17(3,4)9-6-10-18(15,5)16(12)14(20)11-13(2)19/h7,11,15-16,20H,6,8-10H2,1-5H3/b14-11-/t15-,16+,18-/m0/s1 |
| InChIKey | IYOMABBTSBKXGO-ZFKKFQQRSA-N |
| XLogP | 4.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|