C25H41ClO5 — CID 73086421
(3-acetyloxy-2-hydroxypropyl) 2-chloro-2,4b,8,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate (PubChem CID 73086421) has the molecular formula C25H41ClO5 and a molecular weight of 457.05 g/mol. Its IUPAC name is (3-acetyloxy-2-hydroxypropyl) 2-chloro-2,4b,8,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate.
| Compound Name | (3-acetyloxy-2-hydroxypropyl) 2-chloro-2,4b,8,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 73086421 |
| Molecular Formula | C25H41ClO5 |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (3-acetyloxy-2-hydroxypropyl) 2-chloro-2,4b,8,8,10a-pentamethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1-carboxylate |
| SMILES | CC(=O)OCC(O)COC(=O)C1C(C)(Cl)CCC2C3(C)CCCC(C)(C)C3CCC12C |
| InChI | InChI=1S/C25H41ClO5/c1-16(27)30-14-17(28)15-31-21(29)20-24(5)12-8-18-22(2,3)10-7-11-23(18,4)19(24)9-13-25(20,6)26/h17-20,28H,7-15H2,1-6H3 |
| InChIKey | UQAIPZBSWVAVJG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|