C20H32O — CID 163016119
(1S,4R,9R,10S,13S,14R,16S)-5,5,9,13-tetramethyl-15-oxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecane (PubChem CID 163016119) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,4R,9R,10S,13S,14R,16S)-5,5,9,13-tetramethyl-15-oxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecane.
| Compound Name | (1S,4R,9R,10S,13S,14R,16S)-5,5,9,13-tetramethyl-15-oxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecane |
|---|---|
| PubChem CID | 163016119 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,4R,9R,10S,13S,14R,16S)-5,5,9,13-tetramethyl-15-oxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecane |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]1CC[C@]13C[C@](C)(CC[C@@H]21)[C@H]1O[C@H]13 |
| InChI | InChI=1S/C20H32O/c1-17(2)8-5-9-19(4)13(17)7-11-20-12-18(3,10-6-14(19)20)15-16(20)21-15/h13-16H,5-12H2,1-4H3/t13-,14+,15+,16-,18+,19-,20+/m1/s1 |
| InChIKey | KDWSLQUUCAGMBE-SZBWWIKHSA-N |
| XLogP | 5.19 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|