C20H36 — CID 166035433
4b,8,8,9a-tetramethyl-2-propan-2-yl-1,2,3,4,4a,5,6,7,8a,9-decahydrofluorene (PubChem CID 166035433) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 4b,8,8,9a-tetramethyl-2-propan-2-yl-1,2,3,4,4a,5,6,7,8a,9-decahydrofluorene.
| Compound Name | 4b,8,8,9a-tetramethyl-2-propan-2-yl-1,2,3,4,4a,5,6,7,8a,9-decahydrofluorene |
|---|---|
| PubChem CID | 166035433 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 4b,8,8,9a-tetramethyl-2-propan-2-yl-1,2,3,4,4a,5,6,7,8a,9-decahydrofluorene |
| SMILES | CC(C)C1CCC2C(C)(C1)CC1C(C)(C)CCCC12C |
| InChI | InChI=1S/C20H36/c1-14(2)15-8-9-16-19(5,12-15)13-17-18(3,4)10-7-11-20(16,17)6/h14-17H,7-13H2,1-6H3 |
| InChIKey | RVCNYJDZRHTOAQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |