C17H32 — CID 57210589
(4aS,8aR)-5,5,8a-trimethyl-2-(2-methylpropyl)-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 57210589) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is (4aS,8aR)-5,5,8a-trimethyl-2-(2-methylpropyl)-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | (4aS,8aR)-5,5,8a-trimethyl-2-(2-methylpropyl)-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 57210589 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | (4aS,8aR)-5,5,8a-trimethyl-2-(2-methylpropyl)-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | CC(C)CC1CC[C@H]2C(C)(C)CCC[C@]2(C)C1 |
| InChI | InChI=1S/C17H32/c1-13(2)11-14-7-8-15-16(3,4)9-6-10-17(15,5)12-14/h13-15H,6-12H2,1-5H3/t14?,15-,17+/m0/s1 |
| InChIKey | WGJCQSFBVSAQIY-IGGKNEPZSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |