C20H30F2O — CID 57070371
(8S,9R,10S,13R,14S)-16,16-difluoro-3,10,13-trimethyl-3,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-one (PubChem CID 57070371) has the molecular formula C20H30F2O and a molecular weight of 324.45 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-16,16-difluoro-3,10,13-trimethyl-3,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-one.
| Compound Name | (8S,9R,10S,13R,14S)-16,16-difluoro-3,10,13-trimethyl-3,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-one |
|---|---|
| PubChem CID | 57070371 |
| Molecular Formula | C20H30F2O |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (8S,9R,10S,13R,14S)-16,16-difluoro-3,10,13-trimethyl-3,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-one |
| SMILES | CC1CC2CC[C@@H]3[C@@H](CC[C@]4(C)CC(F)(F)C[C@@H]34)[C@@]2(C)CC1=O |
| InChI | InChI=1S/C20H30F2O/c1-12-8-13-4-5-14-15(19(13,3)10-17(12)23)6-7-18(2)11-20(21,22)9-16(14)18/h12-16H,4-11H2,1-3H3/t12?,13?,14-,15-,16+,18-,19+/m1/s1 |
| InChIKey | QMWXBDVZDAHKII-PEEOAVNCSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |