C25H39IO2Si — CID 22671186
17-[tert-butyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22671186) has the molecular formula C25H39IO2Si and a molecular weight of 526.58 g/mol. Its IUPAC name is 17-[tert-butyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[tert-butyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22671186 |
| Molecular Formula | C25H39IO2Si |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 17-[tert-butyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC=C3C(CCC4=CC(=O)CCC43CI)C1CCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H39IO2Si/c1-23(2,3)29(5,6)28-22-10-9-20-19-8-7-17-15-18(27)11-14-25(17,16-26)21(19)12-13-24(20,22)4/h12,15,19-20,22H,7-11,13-14,16H2,1-6H3 |
| InChIKey | WKVPIVMWHOEWJK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|