C26H41IO2Si — CID 91543936
(8S,10R,13S,14S)-17-[2,2-dimethylpropyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 91543936) has the molecular formula C26H41IO2Si and a molecular weight of 540.60 g/mol. Its IUPAC name is (8S,10R,13S,14S)-17-[2,2-dimethylpropyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10R,13S,14S)-17-[2,2-dimethylpropyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91543936 |
| Molecular Formula | C26H41IO2Si |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (8S,10R,13S,14S)-17-[2,2-dimethylpropyl(dimethyl)silyl]oxy-10-(iodomethyl)-13-methyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)(C)C[Si](C)(C)OC1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(CI)C3=CC[C@]12C |
| InChI | InChI=1S/C26H41IO2Si/c1-24(2,3)17-30(5,6)29-23-10-9-21-20-8-7-18-15-19(28)11-14-26(18,16-27)22(20)12-13-25(21,23)4/h12,15,20-21,23H,7-11,13-14,16-17H2,1-6H3/t20-,21-,23?,25-,26+/m0/s1 |
| InChIKey | PQNQMLVXCLLEDA-CSNDHTIZSA-N |
| XLogP | 7.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|