C25H38O2 — CID 142204216
4a-ethyl-6a-methyl-7-[(2-methylpropan-2-yl)oxy]-4,6,7,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-2-one (PubChem CID 142204216) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 4a-ethyl-6a-methyl-7-[(2-methylpropan-2-yl)oxy]-4,6,7,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-2-one.
| Compound Name | 4a-ethyl-6a-methyl-7-[(2-methylpropan-2-yl)oxy]-4,6,7,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 142204216 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 4a-ethyl-6a-methyl-7-[(2-methylpropan-2-yl)oxy]-4,6,7,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
| SMILES | CCC12CCC(=O)C=C1CCC1C2=CCC2(C)C(OC(C)(C)C)CCCC12 |
| InChI | InChI=1S/C25H38O2/c1-6-25-15-12-18(26)16-17(25)10-11-19-20-8-7-9-22(27-23(2,3)4)24(20,5)14-13-21(19)25/h13,16,19-20,22H,6-12,14-15H2,1-5H3 |
| InChIKey | KVOZLQLJDFFENQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|