C22H30O2S2 — CID 23645041
(10R,13S)-13-methyl-10-[2-(methylsulfanylmethylsulfanyl)ethyl]-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 23645041) has the molecular formula C22H30O2S2 and a molecular weight of 390.61 g/mol. Its IUPAC name is (10R,13S)-13-methyl-10-[2-(methylsulfanylmethylsulfanyl)ethyl]-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (10R,13S)-13-methyl-10-[2-(methylsulfanylmethylsulfanyl)ethyl]-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 23645041 |
| Molecular Formula | C22H30O2S2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (10R,13S)-13-methyl-10-[2-(methylsulfanylmethylsulfanyl)ethyl]-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CSCSCC[C@]12CCC(=O)C=C1CCC1C2=CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C22H30O2S2/c1-21-9-8-19-17(18(21)5-6-20(21)24)4-3-15-13-16(23)7-10-22(15,19)11-12-26-14-25-2/h8,13,17-18H,3-7,9-12,14H2,1-2H3/t17?,18?,21-,22+/m0/s1 |
| InChIKey | QCMBLYSKNAJZTN-GHZCZGOHSA-N |
| XLogP | 5.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|