C34H61NO2Si2 — CID 15481973
3-[(3S,5S,8S,10S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-5-yl]propanenitrile (PubChem CID 15481973) has the molecular formula C34H61NO2Si2 and a molecular weight of 572.04 g/mol. Its IUPAC name is 3-[(3S,5S,8S,10S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-5-yl]propanenitrile.
| Compound Name | 3-[(3S,5S,8S,10S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-5-yl]propanenitrile |
|---|---|
| PubChem CID | 15481973 |
| Molecular Formula | C34H61NO2Si2 |
| Molecular Weight | 572.04 g/mol |
| Exact Mass | 571.42 |
| IUPAC Name | 3-[(3S,5S,8S,10S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-1,2,3,4,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-5-yl]propanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@]2(C)C3=CC[C@]4(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]4[C@@H]3CC[C@]2(CCC#N)C1 |
| InChI | InChI=1S/C34H61NO2Si2/c1-30(2,3)38(9,10)36-25-16-21-33(8)28-18-20-32(7)27(14-15-29(32)37-39(11,12)31(4,5)6)26(28)17-22-34(33,24-25)19-13-23-35/h18,25-27,29H,13-17,19-22,24H2,1-12H3/t25-,26-,27-,29-,32-,33+,34+/m0/s1 |
| InChIKey | SFODKXOKUHOELC-CYCFYEPRSA-N |
| XLogP | 10.40 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.04 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|