C18H31NO3Si — CID 11772082
2-[(2S,3R,4aS,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,8-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[3,2-b]pyran-2-yl]acetonitrile (PubChem CID 11772082) has the molecular formula C18H31NO3Si and a molecular weight of 337.54 g/mol. Its IUPAC name is 2-[(2S,3R,4aS,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,8-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[3,2-b]pyran-2-yl]acetonitrile.
| Compound Name | 2-[(2S,3R,4aS,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,8-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[3,2-b]pyran-2-yl]acetonitrile |
|---|---|
| PubChem CID | 11772082 |
| Molecular Formula | C18H31NO3Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2-[(2S,3R,4aS,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-2,8-dimethyl-4,4a,6,8a-tetrahydro-3H-pyrano[3,2-b]pyran-2-yl]acetonitrile |
| SMILES | CC1=CCO[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(CC#N)O[C@H]12 |
| InChI | InChI=1S/C18H31NO3Si/c1-13-8-11-20-14-12-15(22-23(6,7)17(2,3)4)18(5,9-10-19)21-16(13)14/h8,14-16H,9,11-12H2,1-7H3/t14-,15+,16+,18-/m0/s1 |
| InChIKey | LCFBONDREIEKFG-LHHMISFZSA-N |
| XLogP | 4.18 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|