C24H31N3O6Si — CID 11670287
[(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 11670287) has the molecular formula C24H31N3O6Si and a molecular weight of 485.61 g/mol. Its IUPAC name is [(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11670287 |
| Molecular Formula | C24H31N3O6Si |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [(2S,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cc1cn([C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C#N)(COC(=O)c3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H31N3O6Si/c1-16-13-27(22(30)26-20(16)28)19-12-18(33-34(5,6)23(2,3)4)24(14-25,32-19)15-31-21(29)17-10-8-7-9-11-17/h7-11,13,18-19H,12,15H2,1-6H3,(H,26,28,30)/t18-,19-,24+/m1/s1 |
| InChIKey | WAPPKTKIMLKXRC-IECBHUPTSA-N |
| XLogP | 3.27 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|