C18H28N2O5Si — CID 16719922
1-[(2S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethynyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 16719922) has the molecular formula C18H28N2O5Si and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-[(2S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethynyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethynyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16719922 |
| Molecular Formula | C18H28N2O5Si |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[(2S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethynyl-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C#C[C@]1(CO[Si](C)(C)C(C)(C)C)O[C@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C18H28N2O5Si/c1-8-18(11-24-26(6,7)17(3,4)5)13(21)9-14(25-18)20-10-12(2)15(22)19-16(20)23/h1,10,13-14,21H,9,11H2,2-7H3,(H,19,22,23)/t13-,14-,18+/m0/s1 |
| InChIKey | AQTQHKKPMSUIBP-SUNYJGFJSA-N |
| XLogP | 1.52 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|