C11H11Ac2FN2O5 — CID 59968642
actinium;1-[(2R,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 59968642) has the molecular formula C11H11Ac2FN2O5 and a molecular weight of 724.22 g/mol. Its IUPAC name is actinium;1-[(2R,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | actinium;1-[(2R,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59968642 |
| Molecular Formula | C11H11Ac2FN2O5 |
| Molecular Weight | 724.22 g/mol |
| Exact Mass | 724.12 |
| IUPAC Name | actinium;1-[(2R,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cc(F)c(=O)[nH]c2=O)CC1O.[Ac].[Ac] |
| InChI | InChI=1S/C11H11FN2O5.2Ac/c1-2-11(5-15)7(16)3-8(19-11)14-4-6(12)9(17)13-10(14)18;;/h1,4,7-8,15-16H,3,5H2,(H,13,17,18);;/t7?,8-,11-;;/m1../s1 |
| InChIKey | MIPUSYGIYLVGSE-KYDJVZKRSA-N |
| XLogP | -1.68 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.22 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|