C34H43IN2O7SSi — CID 102093405
[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-iodophenyl)-2-methylpropyl]sulfanylcarbonyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 102093405) has the molecular formula C34H43IN2O7SSi and a molecular weight of 778.78 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-iodophenyl)-2-methylpropyl]sulfanylcarbonyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-iodophenyl)-2-methylpropyl]sulfanylcarbonyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 102093405 |
| Molecular Formula | C34H43IN2O7SSi |
| Molecular Weight | 778.78 g/mol |
| Exact Mass | 778.16 |
| IUPAC Name | [(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-iodophenyl)-2-methylpropyl]sulfanylcarbonyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@](COC(=O)c3ccccc3)(C(=O)SCC(C)(C)c3ccccc3I)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H43IN2O7SSi/c1-22-19-37(31(41)36-28(22)38)27-18-26(44-46(7,8)32(2,3)4)34(43-27,20-42-29(39)23-14-10-9-11-15-23)30(40)45-21-33(5,6)24-16-12-13-17-25(24)35/h9-17,19,26-27H,18,20-21H2,1-8H3,(H,36,38,41)/t26-,27+,34+/m0/s1 |
| InChIKey | NYFVUYPMHGBETA-RCUDDFTLSA-N |
| XLogP | 6.59 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.78 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|