C31H43NO3 — CID 166488298
(13'S)-11'-[4-(dimethylamino)phenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol;prop-1-yne (PubChem CID 166488298) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is (13'S)-11'-[4-(dimethylamino)phenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol;prop-1-yne.
| Compound Name | (13'S)-11'-[4-(dimethylamino)phenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol;prop-1-yne |
|---|---|
| PubChem CID | 166488298 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | (13'S)-11'-[4-(dimethylamino)phenyl]-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-17'-ol;prop-1-yne |
| SMILES | C#CC.CN(C)c1ccc(C2C[C@]3(C)C(O)CCC3C3CCC4CC5(CCC4=C23)OCCO5)cc1 |
| InChI | InChI=1S/C28H39NO3.C3H4/c1-27-17-23(18-4-7-20(8-5-18)29(2)3)26-21-12-13-28(31-14-15-32-28)16-19(21)6-9-22(26)24(27)10-11-25(27)30;1-3-2/h4-5,7-8,19,22-25,30H,6,9-17H2,1-3H3;1H,2H3/t19?,22?,23?,24?,25?,27-;/m0./s1 |
| InChIKey | VNSFSTXORDKXQY-GRHHENOPSA-N |
| XLogP | 5.91 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|