C30H39NO2 — CID 166488285
4-[(13'R)-17'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]-N,N-dimethylaniline (PubChem CID 166488285) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is 4-[(13'R)-17'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]-N,N-dimethylaniline.
| Compound Name | 4-[(13'R)-17'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 166488285 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 4-[(13'R)-17'-ethynyl-13'-methylspiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]-N,N-dimethylaniline |
| SMILES | C#CC1CCC2C3CCC4CC5(CCC4=C3C(c3ccc(N(C)C)cc3)C[C@@]12C)OCCO5 |
| InChI | InChI=1S/C30H39NO2/c1-5-22-9-13-27-25-12-8-21-18-30(32-16-17-33-30)15-14-24(21)28(25)26(19-29(22,27)2)20-6-10-23(11-7-20)31(3)4/h1,6-7,10-11,21-22,25-27H,8-9,12-19H2,2-4H3/t21?,22?,25?,26?,27?,29-/m0/s1 |
| InChIKey | HFDWZFXXOPSAIC-LAKIHFGJSA-N |
| XLogP | 6.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|