C34H47FN2O4 — CID 130435789
1-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]-3-(2-oxoethyl)urea (PubChem CID 130435789) has the molecular formula C34H47FN2O4 and a molecular weight of 566.76 g/mol. Its IUPAC name is 1-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]-3-(2-oxoethyl)urea.
| Compound Name | 1-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]-3-(2-oxoethyl)urea |
|---|---|
| PubChem CID | 130435789 |
| Molecular Formula | C34H47FN2O4 |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | 1-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]-3-(2-oxoethyl)urea |
| SMILES | CC1(C)COC2(CCC3=C4C(c5ccc(CNC(=O)NCC=O)cc5)CC5(C)C(CF)CCC5C4CCC3C2)OC1 |
| InChI | InChI=1S/C34H47FN2O4/c1-32(2)20-40-34(41-21-32)13-12-26-24(16-34)8-10-27-29-11-9-25(18-35)33(29,3)17-28(30(26)27)23-6-4-22(5-7-23)19-37-31(39)36-14-15-38/h4-7,15,24-25,27-29H,8-14,16-21H2,1-3H3,(H2,36,37,39) |
| InChIKey | SFURRPOUVZFTPI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|