C32H44O3 — CID 123683667
11-(4-ethenylphenyl)-5',5',13,17-tetramethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5-ol (PubChem CID 123683667) has the molecular formula C32H44O3 and a molecular weight of 476.70 g/mol. Its IUPAC name is 11-(4-ethenylphenyl)-5',5',13,17-tetramethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5-ol.
| Compound Name | 11-(4-ethenylphenyl)-5',5',13,17-tetramethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5-ol |
|---|---|
| PubChem CID | 123683667 |
| Molecular Formula | C32H44O3 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 11-(4-ethenylphenyl)-5',5',13,17-tetramethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-5-ol |
| SMILES | C=Cc1ccc(C2CC3(C)C(C)CCC3C3CCC4(O)CC5(CCC4=C23)OCC(C)(C)CO5)cc1 |
| InChI | InChI=1S/C32H44O3/c1-6-22-8-10-23(11-9-22)25-17-30(5)21(2)7-12-26(30)24-13-15-31(33)18-32(16-14-27(31)28(24)25)34-19-29(3,4)20-35-32/h6,8-11,21,24-26,33H,1,7,12-20H2,2-5H3 |
| InChIKey | LUVKTKXVYGOPRU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|