C33H46O4 — CID 118312070
(11'R,17'S)-5,5,13',17'-tetramethyl-11'-(3-prop-1-en-2-ylphenyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol (PubChem CID 118312070) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is (11'R,17'S)-5,5,13',17'-tetramethyl-11'-(3-prop-1-en-2-ylphenyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol.
| Compound Name | (11'R,17'S)-5,5,13',17'-tetramethyl-11'-(3-prop-1-en-2-ylphenyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
|---|---|
| PubChem CID | 118312070 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (11'R,17'S)-5,5,13',17'-tetramethyl-11'-(3-prop-1-en-2-ylphenyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
| SMILES | C=C(C)c1cccc([C@H]2CC3(C)C(CC[C@]3(C)O)C3CCC4(O)CC5(CCC4=C32)OCC(C)(C)CO5)c1 |
| InChI | InChI=1S/C33H46O4/c1-21(2)22-8-7-9-23(16-22)25-17-30(5)26(11-13-31(30,6)34)24-10-14-32(35)18-33(15-12-27(32)28(24)25)36-19-29(3,4)20-37-33/h7-9,16,24-26,34-35H,1,10-15,17-20H2,2-6H3/t24?,25-,26?,30?,31+,32?/m1/s1 |
| InChIKey | SEXFQVHJTGQFNM-BWBMHECSSA-N |
| XLogP | 6.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|