C40H52O4S — CID 118312065
17'-ethyl-5,5,13'-trimethyl-11'-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol (PubChem CID 118312065) has the molecular formula C40H52O4S and a molecular weight of 628.92 g/mol. Its IUPAC name is 17'-ethyl-5,5,13'-trimethyl-11'-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol.
| Compound Name | 17'-ethyl-5,5,13'-trimethyl-11'-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
|---|---|
| PubChem CID | 118312065 |
| Molecular Formula | C40H52O4S |
| Molecular Weight | 628.92 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 17'-ethyl-5,5,13'-trimethyl-11'-[4-[(E)-2-(4-methylsulfanylphenyl)ethenyl]phenyl]spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
| SMILES | CCC1(O)CCC2C3CCC4(O)CC5(CCC4=C3C(c3ccc(/C=C/c4ccc(SC)cc4)cc3)CC21C)OCC(C)(C)CO5 |
| InChI | InChI=1S/C40H52O4S/c1-6-39(42)21-18-33-31-17-20-38(41)24-40(43-25-36(2,3)26-44-40)22-19-34(38)35(31)32(23-37(33,39)4)29-13-9-27(10-14-29)7-8-28-11-15-30(45-5)16-12-28/h7-16,31-33,41-42H,6,17-26H2,1-5H3/b8-7+ |
| InChIKey | RYJZKCAIELSBNE-BQYQJAHWSA-N |
| XLogP | 9.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.92 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|