C31H43NO4 — CID 88985652
(11'R,13'S)-11'-(4-methanimidoylphenyl)-5,5,13',17'-tetramethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol (PubChem CID 88985652) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (11'R,13'S)-11'-(4-methanimidoylphenyl)-5,5,13',17'-tetramethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol.
| Compound Name | (11'R,13'S)-11'-(4-methanimidoylphenyl)-5,5,13',17'-tetramethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
|---|---|
| PubChem CID | 88985652 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (11'R,13'S)-11'-(4-methanimidoylphenyl)-5,5,13',17'-tetramethylspiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-5',17'-diol |
| SMILES | [H]/N=C/c1ccc([C@H]2C[C@@]3(C)C(CCC3(C)O)C3CCC4(O)CC5(CCC4=C32)OCC(C)(C)CO5)cc1 |
| InChI | InChI=1S/C31H43NO4/c1-27(2)18-35-31(36-19-27)14-11-25-26-22(9-13-30(25,34)17-31)24-10-12-29(4,33)28(24,3)15-23(26)21-7-5-20(16-32)6-8-21/h5-8,16,22-24,32-34H,9-15,17-19H2,1-4H3/b32-16+/t22?,23-,24?,28+,29?,30?/m1/s1 |
| InChIKey | VAJYHFSGLMBXNW-PAJTURMESA-N |
| XLogP | 5.73 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|