C34H49FN2O3 — CID 130435591
1-ethyl-3-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]urea (PubChem CID 130435591) has the molecular formula C34H49FN2O3 and a molecular weight of 552.78 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 130435591 |
| Molecular Formula | C34H49FN2O3 |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | 1-ethyl-3-[[4-[17'-(fluoromethyl)-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccc(C2CC3(C)C(CF)CCC3C3CCC4CC5(CCC4=C23)OCC(C)(C)CO5)cc1 |
| InChI | InChI=1S/C34H49FN2O3/c1-5-36-31(38)37-19-22-6-8-23(9-7-22)28-17-33(4)25(18-35)11-13-29(33)27-12-10-24-16-34(15-14-26(24)30(27)28)39-20-32(2,3)21-40-34/h6-9,24-25,27-29H,5,10-21H2,1-4H3,(H2,36,37,38) |
| InChIKey | GTEYZGWPNWVLAO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|