C27H34O3S — CID 145160715
13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (PubChem CID 145160715) has the molecular formula C27H34O3S and a molecular weight of 438.63 g/mol. Its IUPAC name is 13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one.
| Compound Name | 13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|---|
| PubChem CID | 145160715 |
| Molecular Formula | C27H34O3S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| SMILES | CSc1ccc(C2CC3(C)C(=O)CCC3C3CCC4CC5(CCC4=C23)OCCO5)cc1 |
| InChI | InChI=1S/C27H34O3S/c1-26-16-22(17-3-6-19(31-2)7-4-17)25-20-11-12-27(29-13-14-30-27)15-18(20)5-8-21(25)23(26)9-10-24(26)28/h3-4,6-7,18,21-23H,5,8-16H2,1-2H3 |
| InChIKey | CKBSDWUCRSRNMA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|