C29H36O4S — CID 122577646
(5'R,13'S)-11'-(4-cyclopropylsulfanylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 122577646) has the molecular formula C29H36O4S and a molecular weight of 480.67 g/mol. Its IUPAC name is (5'R,13'S)-11'-(4-cyclopropylsulfanylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (5'R,13'S)-11'-(4-cyclopropylsulfanylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 122577646 |
| Molecular Formula | C29H36O4S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (5'R,13'S)-11'-(4-cyclopropylsulfanylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | C[C@]12CC(c3ccc(SC4CC4)cc3)C3=C4CCC5(C[C@]4(O)CCC3C1CCC2=O)OCCO5 |
| InChI | InChI=1S/C29H36O4S/c1-27-16-22(18-2-4-19(5-3-18)34-20-6-7-20)26-21(23(27)8-9-25(27)30)10-12-28(31)17-29(13-11-24(26)28)32-14-15-33-29/h2-5,20-23,31H,6-17H2,1H3/t21?,22?,23?,27-,28+/m0/s1 |
| InChIKey | GFPIRCNSFJNBCZ-FJXIBAFOSA-N |
| XLogP | 5.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|