C27H33BrO3 — CID 71243266
(5R,11R,13S)-11-(4-bromophenyl)-5-hydroxy-13-methylspiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxolane]-17-one (PubChem CID 71243266) has the molecular formula C27H33BrO3 and a molecular weight of 485.46 g/mol. Its IUPAC name is (5R,11R,13S)-11-(4-bromophenyl)-5-hydroxy-13-methylspiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxolane]-17-one.
| Compound Name | (5R,11R,13S)-11-(4-bromophenyl)-5-hydroxy-13-methylspiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxolane]-17-one |
|---|---|
| PubChem CID | 71243266 |
| Molecular Formula | C27H33BrO3 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (5R,11R,13S)-11-(4-bromophenyl)-5-hydroxy-13-methylspiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxolane]-17-one |
| SMILES | C[C@]12C[C@H](c3ccc(Br)cc3)C3=C4CCC5(CCCO5)C[C@]4(O)CCC3C1CCC2=O |
| InChI | InChI=1S/C27H33BrO3/c1-25-15-20(17-3-5-18(28)6-4-17)24-19(21(25)7-8-23(25)29)9-13-27(30)16-26(11-2-14-31-26)12-10-22(24)27/h3-6,19-21,30H,2,7-16H2,1H3/t19?,20-,21?,25+,26?,27-/m1/s1 |
| InChIKey | STMLDYIBJMACOC-JUGBSXFRSA-N |
| XLogP | 6.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|