C29H38O6 — CID 12044128
(5R,8S,11R,13S,14S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-5-hydroxy-3,3-dimethoxy-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 12044128) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is (5R,8S,11R,13S,14S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-5-hydroxy-3,3-dimethoxy-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,8S,11R,13S,14S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-5-hydroxy-3,3-dimethoxy-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 12044128 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (5R,8S,11R,13S,14S)-11-[4-(1,3-dioxolan-2-yl)phenyl]-5-hydroxy-3,3-dimethoxy-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | COC1(OC)CCC2=C3[C@@H](CC[C@@]2(O)C1)[C@@H]1CCC(=O)[C@@]1(C)C[C@@H]3c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C29H38O6/c1-27-16-21(18-4-6-19(7-5-18)26-34-14-15-35-26)25-20(22(27)8-9-24(27)30)10-12-28(31)17-29(32-2,33-3)13-11-23(25)28/h4-7,20-22,26,31H,8-17H2,1-3H3/t20-,21+,22-,27-,28+/m0/s1 |
| InChIKey | VCIAPUGQFKBNLT-CQRWOGKFSA-N |
| XLogP | 4.82 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|