C30H41NO4 — CID 67832457
(1'S,2'S,4'S,6'S,7'S,9'R,16'R)-9'-[4-(dimethylamino)phenyl]-6'-methoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-10-ene]-16'-ol (PubChem CID 67832457) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is (1'S,2'S,4'S,6'S,7'S,9'R,16'R)-9'-[4-(dimethylamino)phenyl]-6'-methoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-10-ene]-16'-ol.
| Compound Name | (1'S,2'S,4'S,6'S,7'S,9'R,16'R)-9'-[4-(dimethylamino)phenyl]-6'-methoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-10-ene]-16'-ol |
|---|---|
| PubChem CID | 67832457 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (1'S,2'S,4'S,6'S,7'S,9'R,16'R)-9'-[4-(dimethylamino)phenyl]-6'-methoxy-7'-methylspiro[1,3-dioxolane-2,14'-pentacyclo[8.8.0.02,7.04,6.011,16]octadec-10-ene]-16'-ol |
| SMILES | CO[C@@]12C[C@@H]1C[C@H]1[C@@H]3CC[C@@]4(O)CC5(CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@@]12C)OCCO5 |
| InChI | InChI=1S/C30H41NO4/c1-27-17-23(19-5-7-21(8-6-19)31(2)3)26-22(25(27)15-20-16-30(20,27)33-4)9-11-28(32)18-29(12-10-24(26)28)34-13-14-35-29/h5-8,20,22-23,25,32H,9-18H2,1-4H3/t20-,22-,23+,25-,27-,28+,30-/m0/s1 |
| InChIKey | TZGXTPJJSKUPKA-ZLHXMBBTSA-N |
| XLogP | 5.04 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|