C32H40O6 — CID 54767335
CID 54767335 (PubChem CID 54767335) has the molecular formula C32H40O6 and a molecular weight of 520.67 g/mol.
| Compound Name | CID 54767335 |
|---|---|
| PubChem CID | 54767335 |
| Molecular Formula | C32H40O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | — |
| SMILES | C=C1CCO[C@]12CC[C@H]1[C@@H]3CC[C@@]4(O)CC5(CCC4=C3C(c3ccc(C(=O)OC)cc3)C[C@@]12C)OCCO5 |
| InChI | InChI=1S/C32H40O6/c1-20-11-15-38-32(20)14-10-25-23-8-12-30(34)19-31(36-16-17-37-31)13-9-26(30)27(23)24(18-29(25,32)2)21-4-6-22(7-5-21)28(33)35-3/h4-7,23-25,34H,1,8-19H2,2-3H3/t23-,24?,25-,29-,30+,32+/m0/s1 |
| InChIKey | SGIRJVLCAFZGPL-NHTNYYSFSA-N |
| XLogP | 5.46 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|