C32H48O7 — CID 15542988
(5R,8S,11R,13S,14S,17S)-11-[4-(dimethoxymethyl)phenyl]-3,3,17-trimethoxy-17-(methoxymethyl)-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-5-ol (PubChem CID 15542988) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is (5R,8S,11R,13S,14S,17S)-11-[4-(dimethoxymethyl)phenyl]-3,3,17-trimethoxy-17-(methoxymethyl)-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-5-ol.
| Compound Name | (5R,8S,11R,13S,14S,17S)-11-[4-(dimethoxymethyl)phenyl]-3,3,17-trimethoxy-17-(methoxymethyl)-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-5-ol |
|---|---|
| PubChem CID | 15542988 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (5R,8S,11R,13S,14S,17S)-11-[4-(dimethoxymethyl)phenyl]-3,3,17-trimethoxy-17-(methoxymethyl)-13-methyl-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-5-ol |
| SMILES | COC[C@]1(OC)CC[C@H]2[C@@H]3CC[C@@]4(O)CC(OC)(OC)CCC4=C3[C@@H](c3ccc(C(OC)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C32H48O7/c1-29-18-24(21-8-10-22(11-9-21)28(35-3)36-4)27-23(25(29)13-16-31(29,37-5)20-34-2)12-15-30(33)19-32(38-6,39-7)17-14-26(27)30/h8-11,23-25,28,33H,12-20H2,1-7H3/t23-,24+,25-,29-,30+,31+/m0/s1 |
| InChIKey | IQVYAWVLQMNEPS-WYIOVIJPSA-N |
| XLogP | 5.52 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|