C33H46O4 — CID 122577662
(5'R,13'S)-11'-(4-heptylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 122577662) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is (5'R,13'S)-11'-(4-heptylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (5'R,13'S)-11'-(4-heptylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 122577662 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (5'R,13'S)-11'-(4-heptylphenyl)-5'-hydroxy-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CCCCCCCc1ccc(C2C[C@]3(C)C(=O)CCC3C3CC[C@@]4(O)CC5(CCC4=C23)OCCO5)cc1 |
| InChI | InChI=1S/C33H46O4/c1-3-4-5-6-7-8-23-9-11-24(12-10-23)26-21-31(2)27(13-14-29(31)34)25-15-17-32(35)22-33(36-19-20-37-33)18-16-28(32)30(25)26/h9-12,25-27,35H,3-8,13-22H2,1-2H3/t25?,26?,27?,31-,32+/m0/s1 |
| InChIKey | VQFUPTCBEWBARY-BQBVPBKGSA-N |
| XLogP | 7.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|