C30H39IO4 — CID 121379637
1-[(5R,8S,13S,14S,16R,17S)-16-ethyl-5-hydroxy-11-(4-iodophenyl)-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone (PubChem CID 121379637) has the molecular formula C30H39IO4 and a molecular weight of 590.54 g/mol. Its IUPAC name is 1-[(5R,8S,13S,14S,16R,17S)-16-ethyl-5-hydroxy-11-(4-iodophenyl)-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone.
| Compound Name | 1-[(5R,8S,13S,14S,16R,17S)-16-ethyl-5-hydroxy-11-(4-iodophenyl)-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone |
|---|---|
| PubChem CID | 121379637 |
| Molecular Formula | C30H39IO4 |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 1-[(5R,8S,13S,14S,16R,17S)-16-ethyl-5-hydroxy-11-(4-iodophenyl)-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl]ethanone |
| SMILES | CC[C@@H]1C[C@H]2[C@@H]3CC[C@@]4(O)CC5(CCC4=C3C(c3ccc(I)cc3)C[C@]2(C)[C@H]1C(C)=O)OCCO5 |
| InChI | InChI=1S/C30H39IO4/c1-4-19-15-25-22-9-11-29(33)17-30(34-13-14-35-30)12-10-24(29)26(22)23(20-5-7-21(31)8-6-20)16-28(25,3)27(19)18(2)32/h5-8,19,22-23,25,27,33H,4,9-17H2,1-3H3/t19-,22+,23?,25+,27+,28+,29-/m1/s1 |
| InChIKey | FHDVTCWZTWDZHC-ZACRHWPSSA-N |
| XLogP | 6.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|