C28H38O4 — CID 71243359
(5R,11R,13S,17S)-11-[4-(hydroxymethyl)phenyl]-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-oxolane]-5,17-diol (PubChem CID 71243359) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is (5R,11R,13S,17S)-11-[4-(hydroxymethyl)phenyl]-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-oxolane]-5,17-diol.
| Compound Name | (5R,11R,13S,17S)-11-[4-(hydroxymethyl)phenyl]-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-oxolane]-5,17-diol |
|---|---|
| PubChem CID | 71243359 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (5R,11R,13S,17S)-11-[4-(hydroxymethyl)phenyl]-13-methylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-oxolane]-5,17-diol |
| SMILES | C[C@]12C[C@H](c3ccc(CO)cc3)C3=C4CCC5(CCCO5)C[C@]4(O)CCC3C1CC[C@@H]2O |
| InChI | InChI=1S/C28H38O4/c1-26-15-21(19-5-3-18(16-29)4-6-19)25-20(22(26)7-8-24(26)30)9-13-28(31)17-27(11-2-14-32-27)12-10-23(25)28/h3-6,20-22,24,29-31H,2,7-17H2,1H3/t20?,21-,22?,24+,26+,27?,28-/m1/s1 |
| InChIKey | KYDFQRVZSYDWGS-QUZCOFPMSA-N |
| XLogP | 4.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|