C29H40O2 — CID 142139760
11-[4-(1-methoxyethyl)phenyl]-3,3,13-trimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 142139760) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is 11-[4-(1-methoxyethyl)phenyl]-3,3,13-trimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | 11-[4-(1-methoxyethyl)phenyl]-3,3,13-trimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 142139760 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 11-[4-(1-methoxyethyl)phenyl]-3,3,13-trimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COC(C)c1ccc(C2CC3(C)C(=O)CCC3C3CCC4CC(C)(C)CCC4=C23)cc1 |
| InChI | InChI=1S/C29H40O2/c1-18(31-5)19-6-8-20(9-7-19)24-17-29(4)25(12-13-26(29)30)23-11-10-21-16-28(2,3)15-14-22(21)27(23)24/h6-9,18,21,23-25H,10-17H2,1-5H3 |
| InChIKey | FOGDDAMOPOZTNM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|