C36H35O5P — CID 59204333
(8S,11R,13S,14S)-11-(4-diphenoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 59204333) has the molecular formula C36H35O5P and a molecular weight of 578.65 g/mol. Its IUPAC name is (8S,11R,13S,14S)-11-(4-diphenoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8S,11R,13S,14S)-11-(4-diphenoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 59204333 |
| Molecular Formula | C36H35O5P |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | (8S,11R,13S,14S)-11-(4-diphenoxyphosphorylphenyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C[C@H](c3ccc(P(=O)(Oc4ccccc4)Oc4ccccc4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C36H35O5P/c1-36-23-32(35-30-19-15-26(37)22-25(30)14-18-31(35)33(36)20-21-34(36)38)24-12-16-29(17-13-24)42(39,40-27-8-4-2-5-9-27)41-28-10-6-3-7-11-28/h2-13,16-17,22,31-33H,14-15,18-21,23H2,1H3/t31-,32+,33-,36-/m0/s1 |
| InChIKey | ODOJCCZNUPLQAB-KUXLGPMISA-N |
| XLogP | 8.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|